C22H26N4O2 — CID 108828637
(Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 108828637) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108828637 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)Nc2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-5-26(6-2)19-9-12-21(16(3)13-19)24-15-17(14-23)22(27)25-18-7-10-20(28-4)11-8-18/h7-13,15,24H,5-6H2,1-4H3,(H,25,27)/b17-15- |
| InChIKey | GLZQFYQSVIFBOO-ICFOKQHNSA-N |
| XLogP | 4.31 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|