C21H24ClN4O2- — CID 108855391
(Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(2-hydroxyphenyl)prop-2-enamide chloride (PubChem CID 108855391) has the molecular formula C21H24ClN4O2- and a molecular weight of 399.90 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(2-hydroxyphenyl)prop-2-enamide chloride.
| Compound Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(2-hydroxyphenyl)prop-2-enamide chloride |
|---|---|
| PubChem CID | 108855391 |
| Molecular Formula | C21H24ClN4O2- |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(2-hydroxyphenyl)prop-2-enamide chloride |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)Nc2ccccc2O)c(C)c1.[Cl-] |
| InChI | InChI=1S/C21H24N4O2.ClH/c1-4-25(5-2)17-10-11-18(15(3)12-17)23-14-16(13-22)21(27)24-19-8-6-7-9-20(19)26;/h6-12,14,23,26H,4-5H2,1-3H3,(H,24,27);1H/p-1/b16-14-; |
| InChIKey | PGCSQUPDCXGXLL-ULQCMBKMSA-M |
| XLogP | 1.01 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|