C23H28N4O — CID 108840164
(Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(1-phenylethyl)prop-2-enamide (PubChem CID 108840164) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108840164 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (Z)-2-cyano-3-[4-(diethylamino)-2-methylanilino]-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)NC(C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H28N4O/c1-5-27(6-2)21-12-13-22(17(3)14-21)25-16-20(15-24)23(28)26-18(4)19-10-8-7-9-11-19/h7-14,16,18,25H,5-6H2,1-4H3,(H,26,28)/b20-16- |
| InChIKey | ZCGVUERGSPVTDW-SILNSSARSA-N |
| XLogP | 4.54 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|