C24H30N4O — CID 108848644
(Z)-2-cyano-3-[4-(diethylamino)anilino]-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide (PubChem CID 108848644) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848644 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H30N4O/c1-5-19-8-10-20(11-9-19)18(4)27-24(29)21(16-25)17-26-22-12-14-23(15-13-22)28(6-2)7-3/h8-15,17-18,26H,5-7H2,1-4H3,(H,27,29)/b21-17- |
| InChIKey | TWWRKXWTYFEMIA-FXBPSFAMSA-N |
| XLogP | 4.79 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|