C21H21N3O3 — CID 108848416
4-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 108848416) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108848416 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-3-15-4-6-16(7-5-15)14(2)24-20(25)18(12-22)13-23-19-10-8-17(9-11-19)21(26)27/h4-11,13-14,23H,3H2,1-2H3,(H,24,25)(H,26,27)/b18-13- |
| InChIKey | RAVLCCAYBLZIRC-AQTBWJFISA-N |
| XLogP | 3.64 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|