C17H20N4OS — CID 108848647
(Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide (PubChem CID 108848647) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848647 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (Z)-2-cyano-3-(4,5-dihydro-1,3-thiazol-2-ylamino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\NC2=NCCS2)cc1 |
| InChI | InChI=1S/C17H20N4OS/c1-3-13-4-6-14(7-5-13)12(2)21-16(22)15(10-18)11-20-17-19-8-9-23-17/h4-7,11-12H,3,8-9H2,1-2H3,(H,19,20)(H,21,22)/b15-11- |
| InChIKey | FUGIZEFCSJCLJU-PTNGSMBKSA-N |
| XLogP | 2.53 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|