C20H19Cl2N3O — CID 108848421
(Z)-2-cyano-3-(2,3-dichloroanilino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide (PubChem CID 108848421) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,3-dichloroanilino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,3-dichloroanilino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848421 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (Z)-2-cyano-3-(2,3-dichloroanilino)-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O/c1-3-14-7-9-15(10-8-14)13(2)25-20(26)16(11-23)12-24-18-6-4-5-17(21)19(18)22/h4-10,12-13,24H,3H2,1-2H3,(H,25,26)/b16-12- |
| InChIKey | YTWQMJDMMUHTIL-VBKFSLOCSA-N |
| XLogP | 5.25 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|