C18H20N4OS — CID 108848534
(Z)-2-cyano-N-[1-(4-ethylphenyl)ethyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide (PubChem CID 108848534) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-[1-(4-ethylphenyl)ethyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[1-(4-ethylphenyl)ethyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108848534 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (Z)-2-cyano-N-[1-(4-ethylphenyl)ethyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-4-14-5-7-15(8-6-14)13(3)22-17(23)16(9-19)10-20-18-21-12(2)11-24-18/h5-8,10-11,13H,4H2,1-3H3,(H,20,21)(H,22,23)/b16-10- |
| InChIKey | JNWUYHJXEHMICV-YBEGLDIGSA-N |
| XLogP | 3.71 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|