C20H22N4OS — CID 108848907
(Z)-2-cyano-3-[(4-methyl-1,3-thiazol-2-yl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108848907) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(4-methyl-1,3-thiazol-2-yl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(4-methyl-1,3-thiazol-2-yl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848907 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (Z)-2-cyano-3-[(4-methyl-1,3-thiazol-2-yl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | Cc1csc(N/C=C(/C#N)C(=O)NC(C)c2ccc3c(c2)CCCC3)n1 |
| InChI | InChI=1S/C20H22N4OS/c1-13-12-26-20(23-13)22-11-18(10-21)19(25)24-14(2)16-8-7-15-5-3-4-6-17(15)9-16/h7-9,11-12,14H,3-6H2,1-2H3,(H,22,23)(H,24,25)/b18-11- |
| InChIKey | UTLLXRBISABOMQ-WQRHYEAKSA-N |
| XLogP | 4.03 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|