C19H25N3O — CID 108848781
(Z)-2-cyano-3-(propylamino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108848781) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-(propylamino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(propylamino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848781 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (Z)-2-cyano-3-(propylamino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | CCCN/C=C(/C#N)C(=O)NC(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H25N3O/c1-3-10-21-13-18(12-20)19(23)22-14(2)16-9-8-15-6-4-5-7-17(15)11-16/h8-9,11,13-14,21H,3-7,10H2,1-2H3,(H,22,23)/b18-13- |
| InChIKey | MNHDZWBXKYFLGY-AQTBWJFISA-N |
| XLogP | 3.15 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|