C22H21Cl2N3O — CID 108848795
(Z)-2-cyano-3-(2,5-dichloroanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108848795) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dichloroanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dichloroanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848795 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dichloroanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1cc(Cl)ccc1Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H21Cl2N3O/c1-14(16-7-6-15-4-2-3-5-17(15)10-16)27-22(28)18(12-25)13-26-21-11-19(23)8-9-20(21)24/h6-11,13-14,26H,2-5H2,1H3,(H,27,28)/b18-13- |
| InChIKey | MLJGDELYYLYBEU-AQTBWJFISA-N |
| XLogP | 5.57 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|