C28H27N3OS — CID 108848880
(Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108848880) has the molecular formula C28H27N3OS and a molecular weight of 453.61 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848880 |
| Molecular Formula | C28H27N3OS |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C\Nc1ccccc1Sc1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C28H27N3OS/c1-20(22-16-15-21-9-5-6-10-23(21)17-22)31-28(32)24(18-29)19-30-26-13-7-8-14-27(26)33-25-11-3-2-4-12-25/h2-4,7-8,11-17,19-20,30H,5-6,9-10H2,1H3,(H,31,32)/b24-19- |
| InChIKey | NULCKNCIUUHLQJ-CLCOLTQESA-N |
| XLogP | 6.41 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|