C29H29N3OS — CID 108848134
(Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide (PubChem CID 108848134) has the molecular formula C29H29N3OS and a molecular weight of 467.64 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848134 |
| Molecular Formula | C29H29N3OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (Z)-2-cyano-3-(2-phenylsulfanylanilino)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C(C#N)=C\Nc1ccccc1Sc1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C29H29N3OS/c1-2-26(23-17-16-21-10-6-7-11-22(21)18-23)32-29(33)24(19-30)20-31-27-14-8-9-15-28(27)34-25-12-4-3-5-13-25/h3-5,8-9,12-18,20,26,31H,2,6-7,10-11H2,1H3,(H,32,33)/b24-20- |
| InChIKey | TWMSGSFRGPBCBB-GFMRDNFCSA-N |
| XLogP | 6.80 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|