C27H29N3O5 — CID 108848204
dimethyl 2-[[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108848204) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is dimethyl 2-[[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108848204 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | dimethyl 2-[[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCC(NC(=O)/C(C#N)=C\Nc1cc(C(=O)OC)ccc1C(=O)OC)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H29N3O5/c1-4-23(19-10-9-17-7-5-6-8-18(17)13-19)30-25(31)21(15-28)16-29-24-14-20(26(32)34-2)11-12-22(24)27(33)35-3/h9-14,16,23,29H,4-8H2,1-3H3,(H,30,31)/b21-16- |
| InChIKey | NQJPURPUDLFRJU-PGMHBOJBSA-N |
| XLogP | 4.23 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|