C29H30N4O — CID 108848212
(Z)-3-(N-(4-aminophenyl)anilino)-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide (PubChem CID 108848212) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is (Z)-3-(N-(4-aminophenyl)anilino)-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-3-(N-(4-aminophenyl)anilino)-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848212 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (Z)-3-(N-(4-aminophenyl)anilino)-2-cyano-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C(C#N)=C\N(c1ccccc1)c1ccc(N)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C29H30N4O/c1-2-28(23-13-12-21-8-6-7-9-22(21)18-23)32-29(34)24(19-30)20-33(26-10-4-3-5-11-26)27-16-14-25(31)15-17-27/h3-5,10-18,20,28H,2,6-9,31H2,1H3,(H,32,34)/b24-20- |
| InChIKey | KXIKTKCPDOWRBF-GFMRDNFCSA-N |
| XLogP | 5.96 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|