C24H34N4O3 — CID 108848390
tert-butyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]carbamate (PubChem CID 108848390) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]carbamate |
|---|---|
| PubChem CID | 108848390 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-oxo-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propylamino]prop-1-enyl]carbamate |
| SMILES | CCC(NC(=O)/C(C#N)=C\N(CCN)C(=O)OC(C)(C)C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H34N4O3/c1-5-21(19-11-10-17-8-6-7-9-18(17)14-19)27-22(29)20(15-26)16-28(13-12-25)23(30)31-24(2,3)4/h10-11,14,16,21H,5-9,12-13,25H2,1-4H3,(H,27,29)/b20-16- |
| InChIKey | VWYARAMKGHTJIF-SILNSSARSA-N |
| XLogP | 3.74 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|