C29H36N4O — CID 108848312
(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide (PubChem CID 108848312) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848312 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C(C#N)=C\N1CCN(c2cccc(C)c2C)CC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C29H36N4O/c1-4-27(25-13-12-23-9-5-6-10-24(23)18-25)31-29(34)26(19-30)20-32-14-16-33(17-15-32)28-11-7-8-21(2)22(28)3/h7-8,11-13,18,20,27H,4-6,9-10,14-17H2,1-3H3,(H,31,34)/b26-20- |
| InChIKey | ILRZOHAQEYHKRJ-QOMWVZHYSA-N |
| XLogP | 4.98 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|