C21H29ClN4O3 — CID 108845700
2-[[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]amino]-3-methylbutanoic acid;hydrochloride (PubChem CID 108845700) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]amino]-3-methylbutanoic acid;hydrochloride.
| Compound Name | 2-[[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]amino]-3-methylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 108845700 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enoyl]amino]-3-methylbutanoic acid;hydrochloride |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)NC(C(=O)O)C(C)C)CC2)c1C.Cl |
| InChI | InChI=1S/C21H28N4O3.ClH/c1-14(2)19(21(27)28)23-20(26)17(12-22)13-24-8-10-25(11-9-24)18-7-5-6-15(3)16(18)4;/h5-7,13-14,19H,8-11H2,1-4H3,(H,23,26)(H,27,28);1H/b17-13-; |
| InChIKey | IDVRYEFFKHMHTF-VSORCOHTSA-N |
| XLogP | 2.48 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|