C20H26N4O3 — CID 108845535
2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 108845535) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 108845535 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyanoprop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)/C(C#N)=C\N1CCN(Cc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C20H26N4O3/c1-15(2)18(20(26)27)22-19(25)17(12-21)14-24-10-8-23(9-11-24)13-16-6-4-3-5-7-16/h3-7,14-15,18H,8-11,13H2,1-2H3,(H,22,25)(H,26,27)/b17-14- |
| InChIKey | MJCHFJJTGJSVTM-VKAVYKQESA-N |
| XLogP | 1.44 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|