C21H20Cl2N4O — CID 108825493
(Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 108825493) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is (Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108825493 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(Cc2ccccc2)CC1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O/c22-18-6-7-19(23)20(12-18)25-21(28)17(13-24)15-27-10-8-26(9-11-27)14-16-4-2-1-3-5-16/h1-7,12,15H,8-11,14H2,(H,25,28)/b17-15- |
| InChIKey | UZPBSABJQRQBMK-ICFOKQHNSA-N |
| XLogP | 4.16 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|