C16H18Cl2N4O — CID 108825604
(Z)-2-cyano-N-(2,5-dichlorophenyl)-3-(4-ethylpiperazin-1-yl)prop-2-enamide (PubChem CID 108825604) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-(4-ethylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-(4-ethylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108825604 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-(4-ethylpiperazin-1-yl)prop-2-enamide |
| SMILES | CCN1CCN(/C=C(/C#N)C(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-2-21-5-7-22(8-6-21)11-12(10-19)16(23)20-15-9-13(17)3-4-14(15)18/h3-4,9,11H,2,5-8H2,1H3,(H,20,23)/b12-11- |
| InChIKey | FEDYEJKDLJICEQ-QXMHVHEDSA-N |
| XLogP | 2.98 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|