C16H20ClN5O — CID 108859672
(Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-ethylpiperazin-1-yl)prop-2-enamide (PubChem CID 108859672) has the molecular formula C16H20ClN5O and a molecular weight of 333.82 g/mol. Its IUPAC name is (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-ethylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-ethylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108859672 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-ethylpiperazin-1-yl)prop-2-enamide |
| SMILES | CCN1CCN(/C=C(/C#N)C(=O)Nc2ccc(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20ClN5O/c1-2-21-5-7-22(8-6-21)11-12(10-18)16(23)20-13-3-4-15(19)14(17)9-13/h3-4,9,11H,2,5-8,19H2,1H3,(H,20,23)/b12-11- |
| InChIKey | FYCRCGHEPCPACD-QXMHVHEDSA-N |
| XLogP | 1.91 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|