C20H22N4O2 — CID 108843039
(Z)-2-cyano-3-(4-ethylpiperazin-1-yl)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide (PubChem CID 108843039) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-ethylpiperazin-1-yl)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-ethylpiperazin-1-yl)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108843039 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (Z)-2-cyano-3-(4-ethylpiperazin-1-yl)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
| SMILES | CCN1CCN(/C=C(/C#N)C(=O)Nc2cccc3c(O)cccc23)CC1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-23-9-11-24(12-10-23)14-15(13-21)20(26)22-18-7-3-6-17-16(18)5-4-8-19(17)25/h3-8,14,25H,2,9-12H2,1H3,(H,22,26)/b15-14- |
| InChIKey | UAAXNVCCYUUOKM-PFONDFGASA-N |
| XLogP | 2.53 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|