C18H18ClF3N4O3 — CID 108859140
ethyl 4-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108859140) has the molecular formula C18H18ClF3N4O3 and a molecular weight of 430.81 g/mol. Its IUPAC name is ethyl 4-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108859140 |
| Molecular Formula | C18H18ClF3N4O3 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | ethyl 4-[(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H18ClF3N4O3/c1-2-29-17(28)26-7-5-25(6-8-26)11-12(10-23)16(27)24-13-3-4-15(19)14(9-13)18(20,21)22/h3-4,9,11H,2,5-8H2,1H3,(H,24,27)/b12-11- |
| InChIKey | GHFGHZCADIZUCS-QXMHVHEDSA-N |
| XLogP | 3.48 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|