C16H16ClN5O5 — CID 108852480
methyl 4-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108852480) has the molecular formula C16H16ClN5O5 and a molecular weight of 393.79 g/mol. Its IUPAC name is methyl 4-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108852480 |
| Molecular Formula | C16H16ClN5O5 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl 4-[(Z)-3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H16ClN5O5/c1-27-16(24)21-6-4-20(5-7-21)10-11(9-18)15(23)19-12-2-3-13(17)14(8-12)22(25)26/h2-3,8,10H,4-7H2,1H3,(H,19,23)/b11-10- |
| InChIKey | ZSMKANFYPGMWDD-KHPPLWFESA-N |
| XLogP | 1.98 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|