C16H16Cl2N4O3 — CID 108825361
methyl 4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108825361) has the molecular formula C16H16Cl2N4O3 and a molecular weight of 383.24 g/mol. Its IUPAC name is methyl 4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108825361 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | methyl 4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H16Cl2N4O3/c1-25-16(24)22-7-5-21(6-8-22)10-11(9-19)15(23)20-13-4-2-3-12(17)14(13)18/h2-4,10H,5-8H2,1H3,(H,20,23)/b11-10- |
| InChIKey | SPOYCOFXUOMBAK-KHPPLWFESA-N |
| XLogP | 2.72 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|