C18H21N3O3 — CID 108851533
methyl 2-[[(Z)-3-(azepan-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108851533) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-(azepan-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-3-(azepan-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108851533 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl 2-[[(Z)-3-(azepan-1-yl)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C\N1CCCCCC1 |
| InChI | InChI=1S/C18H21N3O3/c1-24-18(23)15-8-4-5-9-16(15)20-17(22)14(12-19)13-21-10-6-2-3-7-11-21/h4-5,8-9,13H,2-3,6-7,10-11H2,1H3,(H,20,22)/b14-13- |
| InChIKey | PVEARQHWLYSHMI-YPKPFQOOSA-N |
| XLogP | 2.70 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|