C23H24N4O3 — CID 108827151
ethyl 2-[[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]amino]benzoate (PubChem CID 108827151) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 2-[[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108827151 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | ethyl 2-[[(Z)-2-cyano-3-(4-phenylpiperazin-1-yl)prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N4O3/c1-2-30-23(29)20-10-6-7-11-21(20)25-22(28)18(16-24)17-26-12-14-27(15-13-26)19-8-4-3-5-9-19/h3-11,17H,2,12-15H2,1H3,(H,25,28)/b18-17- |
| InChIKey | IJFCNECZGKFKCX-ZCXUNETKSA-N |
| XLogP | 3.03 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|