C26H30N4O3 — CID 108856116
butyl 2-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoate (PubChem CID 108856116) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108856116 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\N1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C26H30N4O3/c1-3-4-16-33-26(32)23-10-5-6-11-24(23)28-25(31)21(18-27)19-29-12-14-30(15-13-29)22-9-7-8-20(2)17-22/h5-11,17,19H,3-4,12-16H2,1-2H3,(H,28,31)/b21-19- |
| InChIKey | UNUOTVNYAXIAOC-VZCXRCSSSA-N |
| XLogP | 4.12 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|