C21H20Cl2N4O — CID 108825640
(Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108825640) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108825640 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dichlorophenyl)-3-[4-(3-methylphenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)Nc3cc(Cl)ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H20Cl2N4O/c1-15-3-2-4-18(11-15)27-9-7-26(8-10-27)14-16(13-24)21(28)25-20-12-17(22)5-6-19(20)23/h2-6,11-12,14H,7-10H2,1H3,(H,25,28)/b16-14- |
| InChIKey | TWURTZCJVPRZSW-PEZBUJJGSA-N |
| XLogP | 4.47 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|