C24H27ClN4O — CID 108849414
(Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2,6-diethylphenyl)prop-2-enamide (PubChem CID 108849414) has the molecular formula C24H27ClN4O and a molecular weight of 422.96 g/mol. Its IUPAC name is (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2,6-diethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2,6-diethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849414 |
| Molecular Formula | C24H27ClN4O |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2,6-diethylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(C#N)=C\N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H27ClN4O/c1-3-18-7-5-8-19(4-2)23(18)27-24(30)20(16-26)17-28-11-13-29(14-12-28)22-10-6-9-21(25)15-22/h5-10,15,17H,3-4,11-14H2,1-2H3,(H,27,30)/b20-17- |
| InChIKey | ATDGIBGVPDEOQS-JZJYNLBNSA-N |
| XLogP | 4.63 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|