C26H23ClN4OS — CID 108857237
(Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 108857237) has the molecular formula C26H23ClN4OS and a molecular weight of 475.02 g/mol. Its IUPAC name is (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857237 |
| Molecular Formula | C26H23ClN4OS |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2cccc(Cl)c2)CC1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C26H23ClN4OS/c27-21-7-6-8-22(17-21)31-15-13-30(14-16-31)19-20(18-28)26(32)29-24-11-4-5-12-25(24)33-23-9-2-1-3-10-23/h1-12,17,19H,13-16H2,(H,29,32)/b20-19- |
| InChIKey | FAKNTSDYDPXXGG-VXPUYCOJSA-N |
| XLogP | 5.66 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|