C20H18ClN5O3 — CID 108816694
(Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 108816694) has the molecular formula C20H18ClN5O3 and a molecular weight of 411.85 g/mol. Its IUPAC name is (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108816694 |
| Molecular Formula | C20H18ClN5O3 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (Z)-3-[4-(3-chlorophenyl)piperazin-1-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2cccc(Cl)c2)CC1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18ClN5O3/c21-16-4-3-5-17(12-16)25-10-8-24(9-11-25)14-15(13-22)20(27)23-18-6-1-2-7-19(18)26(28)29/h1-7,12,14H,8-11H2,(H,23,27)/b15-14- |
| InChIKey | FUWLPDVJCHXXQR-PFONDFGASA-N |
| XLogP | 3.42 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|