C16H18N4O3 — CID 108816594
(Z)-2-cyano-3-(2-methylpiperidin-1-yl)-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 108816594) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-methylpiperidin-1-yl)-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-methylpiperidin-1-yl)-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108816594 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (Z)-2-cyano-3-(2-methylpiperidin-1-yl)-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | CC1CCCCN1/C=C(/C#N)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O3/c1-12-6-4-5-9-19(12)11-13(10-17)16(21)18-14-7-2-3-8-15(14)20(22)23/h2-3,7-8,11-12H,4-6,9H2,1H3,(H,18,21)/b13-11- |
| InChIKey | NLFKKLCJMUOPIL-QBFSEMIESA-N |
| XLogP | 2.82 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|