C15H16N4O3 — CID 108816475
(Z)-2-cyano-3-(cyclopentylamino)-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 108816475) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-(cyclopentylamino)-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(cyclopentylamino)-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108816475 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (Z)-2-cyano-3-(cyclopentylamino)-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NC1CCCC1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O3/c16-9-11(10-17-12-5-1-2-6-12)15(20)18-13-7-3-4-8-14(13)19(21)22/h3-4,7-8,10,12,17H,1-2,5-6H2,(H,18,20)/b11-10- |
| InChIKey | NFBJJUGHAHISLH-KHPPLWFESA-N |
| XLogP | 2.47 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|