C16H13N5O5S — CID 108816492
(Z)-2-cyano-N-(2-nitrophenyl)-3-(4-sulfamoylanilino)prop-2-enamide (PubChem CID 108816492) has the molecular formula C16H13N5O5S and a molecular weight of 387.38 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-nitrophenyl)-3-(4-sulfamoylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-nitrophenyl)-3-(4-sulfamoylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108816492 |
| Molecular Formula | C16H13N5O5S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (Z)-2-cyano-N-(2-nitrophenyl)-3-(4-sulfamoylanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N5O5S/c17-9-11(10-19-12-5-7-13(8-6-12)27(18,25)26)16(22)20-14-3-1-2-4-15(14)21(23)24/h1-8,10,19H,(H,20,22)(H2,18,25,26)/b11-10- |
| InChIKey | RNZWEVBKBRSBSU-KHPPLWFESA-N |
| XLogP | 1.70 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|