C16H13FN4O3S — CID 108841821
(Z)-2-cyano-3-(4-fluoroanilino)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 108841821) has the molecular formula C16H13FN4O3S and a molecular weight of 360.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-fluoroanilino)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-fluoroanilino)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108841821 |
| Molecular Formula | C16H13FN4O3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (Z)-2-cyano-3-(4-fluoroanilino)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(F)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H13FN4O3S/c17-12-1-3-13(4-2-12)20-10-11(9-18)16(22)21-14-5-7-15(8-6-14)25(19,23)24/h1-8,10,20H,(H,21,22)(H2,19,23,24)/b11-10- |
| InChIKey | OZWRCZIJPPIYFK-KHPPLWFESA-N |
| XLogP | 1.93 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|