C14H18N4O5S — CID 108841963
(Z)-2-cyano-3-(2,2-dimethoxyethylamino)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 108841963) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,2-dimethoxyethylamino)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,2-dimethoxyethylamino)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108841963 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (Z)-2-cyano-3-(2,2-dimethoxyethylamino)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | COC(CN/C=C(/C#N)C(=O)Nc1ccc(S(N)(=O)=O)cc1)OC |
| InChI | InChI=1S/C14H18N4O5S/c1-22-13(23-2)9-17-8-10(7-15)14(19)18-11-3-5-12(6-4-11)24(16,20)21/h3-6,8,13,17H,9H2,1-2H3,(H,18,19)(H2,16,20,21)/b10-8- |
| InChIKey | KNUIEMQSDYKYPU-NTMALXAHSA-N |
| XLogP | -0.11 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|