C20H22N4O4S — CID 108855715
(Z)-2-cyano-N-(4-ethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide (PubChem CID 108855715) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-ethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-ethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108855715 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (Z)-2-cyano-N-(4-ethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C\NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O4S/c1-2-28-18-7-5-17(6-8-18)24-20(25)16(13-21)14-23-12-11-15-3-9-19(10-4-15)29(22,26)27/h3-10,14,23H,2,11-12H2,1H3,(H,24,25)(H2,22,26,27)/b16-14- |
| InChIKey | WJJAHDNQGVZRLC-PEZBUJJGSA-N |
| XLogP | 1.91 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|