C13H14N4O5S — CID 108817610
3-[[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]amino]propanoic acid (PubChem CID 108817610) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817610 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(4-sulfamoylanilino)prop-2-enoyl]amino]propanoic acid |
| SMILES | N#C/C(=C/Nc1ccc(S(N)(=O)=O)cc1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C13H14N4O5S/c14-7-9(13(20)16-6-5-12(18)19)8-17-10-1-3-11(4-2-10)23(15,21)22/h1-4,8,17H,5-6H2,(H,16,20)(H,18,19)(H2,15,21,22)/b9-8- |
| InChIKey | UYNUAXBRUQZQNP-HJWRWDBZSA-N |
| XLogP | -0.26 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|