C13H13ClN4O3 — CID 108817658
3-[[(Z)-3-(4-amino-3-chloroanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108817658) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.73 g/mol. Its IUPAC name is 3-[[(Z)-3-(4-amino-3-chloroanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-3-(4-amino-3-chloroanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817658 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-[[(Z)-3-(4-amino-3-chloroanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | N#C/C(=C/Nc1ccc(N)c(Cl)c1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C13H13ClN4O3/c14-10-5-9(1-2-11(10)16)18-7-8(6-15)13(21)17-4-3-12(19)20/h1-2,5,7,18H,3-4,16H2,(H,17,21)(H,19,20)/b8-7- |
| InChIKey | HSZXVPABUMUNEP-FPLPWBNLSA-N |
| XLogP | 1.33 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|