C14H13Cl2N3O3 — CID 108845801
4-[[(Z)-2-cyano-3-(3,4-dichloroanilino)prop-2-enoyl]amino]butanoic acid (PubChem CID 108845801) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(3,4-dichloroanilino)prop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(3,4-dichloroanilino)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108845801 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(3,4-dichloroanilino)prop-2-enoyl]amino]butanoic acid |
| SMILES | N#C/C(=C/Nc1ccc(Cl)c(Cl)c1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H13Cl2N3O3/c15-11-4-3-10(6-12(11)16)19-8-9(7-17)14(22)18-5-1-2-13(20)21/h3-4,6,8,19H,1-2,5H2,(H,18,22)(H,20,21)/b9-8- |
| InChIKey | YQUQJJZVFNQJMN-HJWRWDBZSA-N |
| XLogP | 2.79 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|