C20H27N3O3 — CID 108845275
6-[[(Z)-3-(4-tert-butylanilino)-2-cyanoprop-2-enoyl]amino]hexanoic acid (PubChem CID 108845275) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 6-[[(Z)-3-(4-tert-butylanilino)-2-cyanoprop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-3-(4-tert-butylanilino)-2-cyanoprop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 108845275 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 6-[[(Z)-3-(4-tert-butylanilino)-2-cyanoprop-2-enoyl]amino]hexanoic acid |
| SMILES | CC(C)(C)c1ccc(N/C=C(/C#N)C(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)16-8-10-17(11-9-16)23-14-15(13-21)19(26)22-12-6-4-5-7-18(24)25/h8-11,14,23H,4-7,12H2,1-3H3,(H,22,26)(H,24,25)/b15-14- |
| InChIKey | ANVDEQSPYAOEKP-PFONDFGASA-N |
| XLogP | 3.56 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|