C14H13ClFN3O3 — CID 108846032
4-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]butanoic acid (PubChem CID 108846032) has the molecular formula C14H13ClFN3O3 and a molecular weight of 325.73 g/mol. Its IUPAC name is 4-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108846032 |
| Molecular Formula | C14H13ClFN3O3 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-[[(Z)-3-(3-chloro-4-fluoroanilino)-2-cyanoprop-2-enoyl]amino]butanoic acid |
| SMILES | N#C/C(=C/Nc1ccc(F)c(Cl)c1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H13ClFN3O3/c15-11-6-10(3-4-12(11)16)19-8-9(7-17)14(22)18-5-1-2-13(20)21/h3-4,6,8,19H,1-2,5H2,(H,18,22)(H,20,21)/b9-8- |
| InChIKey | ZAEXUHJHROQBCE-HJWRWDBZSA-N |
| XLogP | 2.28 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|