C17H14Cl2N4O — CID 108839617
(Z)-3-(4-amino-3-chloroanilino)-N-[(4-chlorophenyl)methyl]-2-cyanoprop-2-enamide (PubChem CID 108839617) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is (Z)-3-(4-amino-3-chloroanilino)-N-[(4-chlorophenyl)methyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(4-amino-3-chloroanilino)-N-[(4-chlorophenyl)methyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108839617 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (Z)-3-(4-amino-3-chloroanilino)-N-[(4-chlorophenyl)methyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(N)c(Cl)c1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N4O/c18-13-3-1-11(2-4-13)9-23-17(24)12(8-20)10-22-14-5-6-16(21)15(19)7-14/h1-7,10,22H,9,21H2,(H,23,24)/b12-10- |
| InChIKey | LLPLDBLMWKCUPI-BENRWUELSA-N |
| XLogP | 3.71 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|