C14H14ClN3O3 — CID 108817561
3-[[(Z)-3-(3-chloro-2-methylanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108817561) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is 3-[[(Z)-3-(3-chloro-2-methylanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-3-(3-chloro-2-methylanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817561 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[[(Z)-3-(3-chloro-2-methylanilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | Cc1c(Cl)cccc1N/C=C(/C#N)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H14ClN3O3/c1-9-11(15)3-2-4-12(9)18-8-10(7-16)14(21)17-6-5-13(19)20/h2-4,8,18H,5-6H2,1H3,(H,17,21)(H,19,20)/b10-8- |
| InChIKey | VSMOITBRURXBKM-NTMALXAHSA-N |
| XLogP | 2.06 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|