C13H11F2N3O3 — CID 108817702
3-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]propanoic acid (PubChem CID 108817702) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.24 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817702 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]propanoic acid |
| SMILES | N#C/C(=C/Nc1c(F)cccc1F)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C13H11F2N3O3/c14-9-2-1-3-10(15)12(9)18-7-8(6-16)13(21)17-5-4-11(19)20/h1-3,7,18H,4-5H2,(H,17,21)(H,19,20)/b8-7- |
| InChIKey | NCMJQWFNEIQPSO-FPLPWBNLSA-N |
| XLogP | 1.38 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|