C15H15F2N3O3 — CID 108845574
2-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 108845574) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 108845574 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)/C(C#N)=C\Nc1c(F)cccc1F)C(=O)O |
| InChI | InChI=1S/C15H15F2N3O3/c1-8(2)12(15(22)23)20-14(21)9(6-18)7-19-13-10(16)4-3-5-11(13)17/h3-5,7-8,12,19H,1-2H3,(H,20,21)(H,22,23)/b9-7- |
| InChIKey | AYNXVCCPTIHOOR-CLFYSBASSA-N |
| XLogP | 2.01 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|