C13H11F2N3O3 — CID 70547626
ethyl N-[2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]carbamate (PubChem CID 70547626) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.25 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 70547626 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | ethyl N-[2-cyano-3-(2,6-difluoroanilino)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=CNc1c(F)cccc1F |
| InChI | InChI=1S/C13H11F2N3O3/c1-2-21-13(20)18-12(19)8(6-16)7-17-11-9(14)4-3-5-10(11)15/h3-5,7,17H,2H2,1H3,(H,18,19,20) |
| InChIKey | BENUHEUFXWNBMG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|