C13H11FN2O3 — CID 177430018
ethyl N-[(Z)-2-cyano-3-(3-fluorophenyl)prop-2-enoyl]carbamate (PubChem CID 177430018) has the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. Its IUPAC name is ethyl N-[(Z)-2-cyano-3-(3-fluorophenyl)prop-2-enoyl]carbamate.
| Compound Name | ethyl N-[(Z)-2-cyano-3-(3-fluorophenyl)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 177430018 |
| Molecular Formula | C13H11FN2O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl N-[(Z)-2-cyano-3-(3-fluorophenyl)prop-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=C\c1cccc(F)c1 |
| InChI | InChI=1S/C13H11FN2O3/c1-2-19-13(18)16-12(17)10(8-15)6-9-4-3-5-11(14)7-9/h3-7H,2H2,1H3,(H,16,17,18)/b10-6- |
| InChIKey | YLDOWCAPFYGMTH-POHAHGRESA-N |
| XLogP | 2.01 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|